3-(dithiophen-2-ylmethylidene)-5-methoxy-1-methylpiperidine
Modify Date: 2025-08-28 19:14:17
3-(dithiophen-2-ylmethylidene)-5-methoxy-1-methylpiperidine structure
|
Common Name | 3-(dithiophen-2-ylmethylidene)-5-methoxy-1-methylpiperidine | ||
|---|---|---|---|---|
| CAS Number | 35012-52-3 | Molecular Weight | 305.45800 | |
| Density | 1.22g/cm3 | Boiling Point | 425.5ºC at 760 mmHg | |
| Molecular Formula | C16H19NOS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.1ºC | |
| Name | 3-(dithiophen-2-ylmethylidene)-5-methoxy-1-methylpiperidine |
|---|
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 425.5ºC at 760 mmHg |
| Molecular Formula | C16H19NOS2 |
| Molecular Weight | 305.45800 |
| Flash Point | 211.1ºC |
| Exact Mass | 305.09100 |
| PSA | 68.95000 |
| LogP | 3.89990 |
| Index of Refraction | 1.622 |
| InChIKey | CDLDDIHSXRLVEM-UHFFFAOYSA-N |
| SMILES | COC1CC(=C(c2cccs2)c2cccs2)CN(C)C1 |
| HS Code | 2934999090 |
|---|
|
~%
3-(dithiophen-2... CAS#:35012-52-3 |
| Literature: Kawazu; Kanno; Saito; Tamaki Journal of medicinal chemistry, 1972 , vol. 15, # 9 p. 914 - 918 |
|
~%
3-(dithiophen-2... CAS#:35012-52-3 |
| Literature: Kawazu; Kanno; Saito; Tamaki Journal of medicinal chemistry, 1972 , vol. 15, # 9 p. 914 - 918 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |