2-Nitro-4,5-bis(trifluoromethyl)benzenamine structure
|
Common Name | 2-Nitro-4,5-bis(trifluoromethyl)benzenamine | ||
|---|---|---|---|---|
| CAS Number | 35010-32-3 | Molecular Weight | 274.12000 | |
| Density | 1.607g/cm3 | Boiling Point | 275.9ºC at 760 mmHg | |
| Molecular Formula | C8H4F6N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.7ºC | |
| Name | 2-Nitro-4,5-bis(trifluoromethyl)aniline |
|---|
| Density | 1.607g/cm3 |
|---|---|
| Boiling Point | 275.9ºC at 760 mmHg |
| Molecular Formula | C8H4F6N2O2 |
| Molecular Weight | 274.12000 |
| Flash Point | 120.7ºC |
| Exact Mass | 274.01800 |
| PSA | 71.84000 |
| LogP | 4.31900 |
| Index of Refraction | 1.463 |
| InChIKey | XCCONFFFCYGZJB-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(F)(F)F)c(C(F)(F)F)cc1[N+](=O)[O-] |
| HS Code | 2921420090 |
|---|
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |