4,4'-Bis[2-(3-methoxyphenyl)ethenyl]-2,2'-bipyridine structure
|
Common Name | 4,4'-Bis[2-(3-methoxyphenyl)ethenyl]-2,2'-bipyridine | ||
|---|---|---|---|---|
| CAS Number | 349545-75-1 | Molecular Weight | 420.50200 | |
| Density | 1.182 | Boiling Point | 627.4ºC at 760 mmHg | |
| Molecular Formula | C28H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.9ºC | |
| Name | 4-[2-(3-methoxyphenyl)ethenyl]-2-[4-[2-(3-methoxyphenyl)ethenyl]pyridin-2-yl]pyridine |
|---|
| Density | 1.182 |
|---|---|
| Boiling Point | 627.4ºC at 760 mmHg |
| Molecular Formula | C28H24N2O2 |
| Molecular Weight | 420.50200 |
| Flash Point | 215.9ºC |
| Exact Mass | 420.18400 |
| PSA | 44.24000 |
| LogP | 6.50160 |
| Index of Refraction | 1.685 |
| InChIKey | SBWREZXAQSZOHI-UHFFFAOYSA-N |
| SMILES | COc1cccc(C=Cc2ccnc(-c3cc(C=Cc4cccc(OC)c4)ccn3)c2)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |