SD-57881
Modify Date: 2025-09-10 20:50:44
SD-57881 structure
|
Common Name | SD-57881 | ||
|---|---|---|---|---|
| CAS Number | 349415-77-6 | Molecular Weight | 347.41202 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H13N3O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SD-57881zinc metalloenzyme modulators （hCA II and HDAC1 modulator） |
| Name | SD-57881 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C15H13N3O3S2 |
| Molecular Weight | 347.41202 |
| Exact Mass | 347.039825 |
| LogP | 3.27 |
| Index of Refraction | 1.700 |
| InChIKey | QBCQRNFZSOLOGV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Nc2nc3ccccc3s2)cc1 |
| N-(1,3-Benzothiazol-2-ylcarbamoyl)-4-methylbenzenesulfonamide |
| Benzenesulfonamide, N-[(2-benzothiazolylamino)carbonyl]-4-methyl- |
| 2-[({[(4-methylphenyl)sulfonyl]amino}carbonyl)amino]-1,3-benzothiazole |