2,7-bis[1-oxo-4-(1-piperidyl)butyl]-9H-fluoren-9-one structure
|
Common Name | 2,7-bis[1-oxo-4-(1-piperidyl)butyl]-9H-fluoren-9-one | ||
|---|---|---|---|---|
| CAS Number | 34924-25-9 | Molecular Weight | 486.64500 | |
| Density | 1.155g/cm3 | Boiling Point | 670.4ºC at 760mmHg | |
| Molecular Formula | C31H38N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.4ºC | |
| Name | 2,7-bis(4-piperidin-1-ylbutanoyl)fluoren-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.155g/cm3 |
|---|---|
| Boiling Point | 670.4ºC at 760mmHg |
| Molecular Formula | C31H38N2O3 |
| Molecular Weight | 486.64500 |
| Flash Point | 280.4ºC |
| Exact Mass | 486.28800 |
| PSA | 57.69000 |
| LogP | 5.67140 |
| Index of Refraction | 1.588 |
| InChIKey | ZNDNZBVYMDSTJN-UHFFFAOYSA-N |
| SMILES | O=C(CCCN1CCCCC1)c1ccc2c(c1)C(=O)c1cc(C(=O)CCCN3CCCCC3)ccc1-2 |
| HS Code | 2933399090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 252-291-0 |