Cetamolol
Modify Date: 2025-08-27 08:12:09
Cetamolol structure
|
Common Name | Cetamolol | ||
|---|---|---|---|---|
| CAS Number | 34919-98-7 | Molecular Weight | 310.38900 | |
| Density | 1.099g/cm3 | Boiling Point | 529ºC at 760mmHg | |
| Molecular Formula | C16H26N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.7ºC | |
| Name | 2-[2-[3-(tert-butylamino)-2-hydroxypropoxy]phenoxy]-N-methylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.099g/cm3 |
|---|---|
| Boiling Point | 529ºC at 760mmHg |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.38900 |
| Flash Point | 273.7ºC |
| Exact Mass | 310.18900 |
| PSA | 79.82000 |
| LogP | 1.72100 |
| Index of Refraction | 1.516 |
| InChIKey | UWCBNAVPISMFJZ-UHFFFAOYSA-N |
| SMILES | CNC(=O)COc1ccccc1OCC(O)CNC(C)(C)C |
| HS Code | 2924299090 |
|---|
|
~%
Cetamolol CAS#:34919-98-7 |
| Literature: Imp.Chem.Ind. Patent: DE2126169 , 1971 ; Chem.Abstr., 1972 , vol. 76, # 72289 |
|
~%
Cetamolol CAS#:34919-98-7 |
| Literature: Imp.Chem.Ind. Patent: DE2126169 , 1971 ; Chem.Abstr., 1972 , vol. 76, # 72289 |
![Benzo[b][1,4]dioxin-2(3H)-one structure](https://image.chemsrc.com/caspic/230/4385-48-2.png)
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Cetamololum |
| 1-t-butylamino-3-(o-N-methylcarbamoylmethoxyphenoxy)propan-2-ol |
| UNII-Z0VD1633O8 |
| CETAMOLOL |
| 1-t-butylamino-3-(o-N-methylcarbamoylmethoxyphenoxy)propane-2-ol |
| Cetamolol [INN] |
| Cetamololum [INN-Latin] |