Acetic acid,2,2-dichloro-, 2-naphthalenyl ester
Modify Date: 2024-04-02 15:18:25
Acetic acid,2,2-dichloro-, 2-naphthalenyl ester structure
|
Common Name | Acetic acid,2,2-dichloro-, 2-naphthalenyl ester | ||
|---|---|---|---|---|
| CAS Number | 34915-55-4 | Molecular Weight | 255.09700 | |
| Density | 1.383g/cm3 | Boiling Point | 354.9ºC at 760 mmHg | |
| Molecular Formula | C12H8Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.7ºC | |
| Name | Dichloressigsaeure-vinylester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.383g/cm3 |
|---|---|
| Boiling Point | 354.9ºC at 760 mmHg |
| Molecular Formula | C12H8Cl2O2 |
| Molecular Weight | 255.09700 |
| Flash Point | 148.7ºC |
| Exact Mass | 253.99000 |
| PSA | 26.30000 |
| LogP | 3.54890 |
| Index of Refraction | 1.624 |
| InChIKey | BINBEEOLDVVDPS-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc2ccccc2c1)C(Cl)Cl |
|
~%
Acetic acid,2,2... CAS#:34915-55-4 |
| Literature: Crompton; Triffit Journal of the Chemical Society, 1921 , vol. 119, p. 1875 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| ethenyl ester |
| Dichlor-essigsaeure-[2]naphthylester |
| dichloro-acetic acid-[2]naphthyl ester |
| Vinyl dichloroacetate |
| dichloro-acetic acid vinyl ester |