2-[[3-(trifluoromethyl)phenyl]amino]acetic acid
Modify Date: 2025-09-18 23:31:08
![2-[[3-(trifluoromethyl)phenyl]amino]acetic acid Structure](https://image.chemsrc.com/caspic/410/349-81-5.png)
2-[[3-(trifluoromethyl)phenyl]amino]acetic acid structure
|
Common Name | 2-[[3-(trifluoromethyl)phenyl]amino]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 349-81-5 | Molecular Weight | 219.16100 | |
| Density | 1.427g/cm3 | Boiling Point | 351ºC at 760 mmHg | |
| Molecular Formula | C9H8F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.1ºC | |
| Name | 2-[3-(trifluoromethyl)anilino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.427g/cm3 |
|---|---|
| Boiling Point | 351ºC at 760 mmHg |
| Molecular Formula | C9H8F3NO2 |
| Molecular Weight | 219.16100 |
| Flash Point | 166.1ºC |
| Exact Mass | 219.05100 |
| PSA | 49.33000 |
| LogP | 2.27490 |
| Index of Refraction | 1.524 |
| InChIKey | JUXDXJXSMIGCPK-UHFFFAOYSA-N |
| SMILES | O=C(O)CNc1cccc(C(F)(F)F)c1 |
| HS Code | 2922499990 |
|---|
|
~%
2-[[3-(trifluor... CAS#:349-81-5 |
| Literature: Maginnity; Gaulin Journal of the American Chemical Society, 1951 , vol. 73, p. 3579 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2-{[3-(trifluoromethyl)phenyl]amino}acetic acid |
| N-(3-Trifluormethyl-phenyl)-glycin |
| N-(m-Trifluormethylphenyl)-glycin |
| DL-[3-(trifluoromethyl)phenyl]-glycine |
| N-(3-trifluoromethyl-phenyl)-glycine |