11,17-dihydroxy-10,13-dimethyl-17-(3-methyloxazolidine-2-carbonyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one structure
|
Common Name | 11,17-dihydroxy-10,13-dimethyl-17-(3-methyloxazolidine-2-carbonyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one | ||
|---|---|---|---|---|
| CAS Number | 34898-28-7 | Molecular Weight | 415.52300 | |
| Density | 1.29g/cm3 | Boiling Point | 596.9ºC at 760 mmHg | |
| Molecular Formula | C24H33NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.8ºC | |
| Name | (8S,9S,10R,13S,14S)-11,17-dihydroxy-10,13-dimethyl-17-(3-methyl-1,3-oxazolidine-2-carbonyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 596.9ºC at 760 mmHg |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.52300 |
| Flash Point | 314.8ºC |
| Exact Mass | 415.23600 |
| PSA | 87.07000 |
| LogP | 1.79130 |
| Index of Refraction | 1.613 |
| InChIKey | VKHXYZXJOXQKDP-UHFFFAOYSA-N |
| SMILES | CN1CCOC1C(=O)C1(O)CCC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC21C |
|
~%
11,17-dihydroxy... CAS#:34898-28-7 |
| Literature: Agnello,E.J.; Farina,P.R. Journal of Medicinal Chemistry, 1972 , vol. 15, p. 363 - 365 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,3,4,5-tetrahydro-1H-1,5-ethano-3-benzazepine hydrochloride |
| 1,5-Ethano-1H-3-benzazepine,2,3,4,5-tetrahydro-,hydrochloride |