3-(dimethylamino)-2,6-bis(1,1-dimethylethyl)-p-cresol structure
|
Common Name | 3-(dimethylamino)-2,6-bis(1,1-dimethylethyl)-p-cresol | ||
|---|---|---|---|---|
| CAS Number | 34869-49-3 | Molecular Weight | 263.41800 | |
| Density | 0.956g/cm3 | Boiling Point | 331.8ºC at 760mmHg | |
| Molecular Formula | C17H29NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.8ºC | |
| Name | 2,6-ditert-butyl-3-(dimethylamino)-4-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.956g/cm3 |
|---|---|
| Boiling Point | 331.8ºC at 760mmHg |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.41800 |
| Flash Point | 116.8ºC |
| Exact Mass | 263.22500 |
| PSA | 23.47000 |
| LogP | 4.36160 |
| Index of Refraction | 1.522 |
| InChIKey | MOGAVOOFUGWHHE-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1N(C)C |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 252-260-1 |