2-(1,1,1,3,3,3-Hexafluoro- 2-hydroxypropan-2-yl) cyclopentanol
Modify Date: 2025-09-13 17:39:52
2-(1,1,1,3,3,3-Hexafluoro- 2-hydroxypropan-2-yl) cyclopentanol structure
|
Common Name | 2-(1,1,1,3,3,3-Hexafluoro- 2-hydroxypropan-2-yl) cyclopentanol | ||
|---|---|---|---|---|
| CAS Number | 34844-38-7 | Molecular Weight | 252.15400 | |
| Density | 1.521g/cm3 | Boiling Point | 257ºC at 760 mmHg | |
| Molecular Formula | C8H10F6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 109.2ºC | |
| Name | 2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclopentan-1-ol |
|---|
| Density | 1.521g/cm3 |
|---|---|
| Boiling Point | 257ºC at 760 mmHg |
| Molecular Formula | C8H10F6O2 |
| Molecular Weight | 252.15400 |
| Flash Point | 109.2ºC |
| Exact Mass | 252.05800 |
| PSA | 40.46000 |
| LogP | 2.00310 |
| Index of Refraction | 1.405 |
| InChIKey | NTZTXVLAIORZPJ-UHFFFAOYSA-N |
| SMILES | OC1CCCC1C(O)(C(F)(F)F)C(F)(F)F |
| HS Code | 2906199090 |
|---|
|
~84%
2-(1,1,1,3,3,3-... CAS#:34844-38-7 |
| Literature: Komata, Takeo; Matsunaga, Kei; Hirotsu, Yoshiki; Akiba, Shinya; Ogura, Katsuyuki Journal of Fluorine Chemistry, 2007 , vol. 128, # 8 p. 902 - 909 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2906199090 |
|---|---|
| Summary | 2906199090. cyclanic, cyclenic or cyclotherpenic alcohols. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |