6-methyl-2,3-dinitroaniline
Modify Date: 2025-10-08 11:20:40
6-methyl-2,3-dinitroaniline structure
|
Common Name | 6-methyl-2,3-dinitroaniline | ||
|---|---|---|---|---|
| CAS Number | 3484-29-5 | Molecular Weight | 197.14800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methyl-2,3-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H7N3O4 |
|---|---|
| Molecular Weight | 197.14800 |
| Exact Mass | 197.04400 |
| PSA | 117.66000 |
| LogP | 3.02120 |
| InChIKey | RQEMAPKTZLEYNM-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1N |
| HS Code | 2921430090 |
|---|
|
~%
6-methyl-2,3-di... CAS#:3484-29-5 |
| Literature: Brady; Williams Journal of the Chemical Society, 1920 , vol. 117, p. 1139 |
|
~%
6-methyl-2,3-di... CAS#:3484-29-5 |
| Literature: Nielsen,A.T. et al. Journal of Organic Chemistry, 1979 , vol. 44, # 14 p. 2499 - 2504 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:610-39-9
CAS#:602-29-9| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 6-methyl-2,3-dinitro-aniline |
| 2,3-dinitro-6-methylaniline |
| Benzenamine,6-methyl-2,3-dinitro |
| 2-amino-3,4-dinitrotoluene |
| 3.4-Dinitro-2-amino-toluol |
| 6-Methyl-2,3-dinitro-anilin |
| aminodinitrotoluene |
| 2-Amino-3.4-dinitrotoluol |