benzyl N-(1-carbamoyl-2-hydroxy-ethyl)carbamate
Modify Date: 2025-09-20 16:56:42
benzyl N-(1-carbamoyl-2-hydroxy-ethyl)carbamate structure
|
Common Name | benzyl N-(1-carbamoyl-2-hydroxy-ethyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 3479-50-3 | Molecular Weight | 238.24000 | |
| Density | 1.303g/cm3 | Boiling Point | 513.7ºC at 760 mmHg | |
| Molecular Formula | C11H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.5ºC | |
| Name | benzyl N-(1-amino-3-hydroxy-1-oxopropan-2-yl)carbamate |
|---|
| Density | 1.303g/cm3 |
|---|---|
| Boiling Point | 513.7ºC at 760 mmHg |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24000 |
| Flash Point | 264.5ºC |
| Exact Mass | 238.09500 |
| PSA | 101.65000 |
| LogP | 0.85020 |
| Index of Refraction | 1.571 |
| InChIKey | NGEWHDOZPGSSLG-UHFFFAOYSA-N |
| SMILES | NC(=O)C(CO)NC(=O)OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |