4-[[4-[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenol
![4-[[4-[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenol Structure](https://image.chemsrc.com/caspic/122/34730-78-4.png)
4-[[4-[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenol structure
|
Common Name | 4-[[4-[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenol | ||
|---|---|---|---|---|
| CAS Number | 34730-78-4 | Molecular Weight | 344.40200 | |
| Density | 1.224g/cm3 | Boiling Point | 527.8ºC at 760mmHg | |
| Molecular Formula | C20H24O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273ºC | |
| Name | 4-[[4-[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.224g/cm3 |
|---|---|
| Boiling Point | 527.8ºC at 760mmHg |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.40200 |
| Flash Point | 273ºC |
| Exact Mass | 344.16200 |
| PSA | 68.15000 |
| LogP | 3.16280 |
| Index of Refraction | 1.594 |
| InChIKey | ROGUIJKVZZROIQ-UHFFFAOYSA-N |
| SMILES | COc1cc(CC2COCC2Cc2ccc(O)c(OC)c2)ccc1O |
| HS Code | 2932190090 |
|---|
|
~%
4-[[4-[(4-hydro... CAS#:34730-78-4 |
| Literature: Matsuura, Shin; Iinuma, Munekazu Phytochemistry (Elsevier), 1985 , vol. 24, # 3 p. 626 - 628 |
|
~%
4-[[4-[(4-hydro... CAS#:34730-78-4 |
| Literature: Matsuura, Shin; Iinuma, Munekazu Phytochemistry (Elsevier), 1985 , vol. 24, # 3 p. 626 - 628 |
|
~%
4-[[4-[(4-hydro... CAS#:34730-78-4 |
| Literature: Matsuura, Shin; Iinuma, Munekazu Phytochemistry (Elsevier), 1985 , vol. 24, # 3 p. 626 - 628 |
|
~%
4-[[4-[(4-hydro... CAS#:34730-78-4 |
| Literature: Matsuura, Shin; Iinuma, Munekazu Phytochemistry (Elsevier), 1985 , vol. 24, # 3 p. 626 - 628 |
|
~%
4-[[4-[(4-hydro... CAS#:34730-78-4 |
| Literature: Matsuura, Shin; Iinuma, Munekazu Phytochemistry (Elsevier), 1985 , vol. 24, # 3 p. 626 - 628 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3,4-Divanilyltetrahydrofuran |
| |A,|A'-(Tetrahydro-3,4-furandiyl)dicreosol |
| deoxomatairesinol |
| tetrahydro-3,4-divanillylfuran |
| 3,4-divanillyltetrahydrofuran |
| 3,4-bis[(3-methoxy-4-hydroxyphenyl)methyl]tetrahydrofuran |
| 2,2'-dimethoxy-4,4'-(tetrahydro-furan-3,4-diyldimethyl)-bis-phenol |
| anhydrosecoisolariciresinol |