2-amino-3,5-dibromo-N-cyclohexyl-N-methylbenzamide
Modify Date: 2025-10-15 17:41:40
2-amino-3,5-dibromo-N-cyclohexyl-N-methylbenzamide structure
|
Common Name | 2-amino-3,5-dibromo-N-cyclohexyl-N-methylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 3472-84-2 | Molecular Weight | 390.11400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18Br2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-3,5-dibromo-N-cyclohexyl-N-methylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18Br2N2O |
|---|---|
| Molecular Weight | 390.11400 |
| Exact Mass | 387.97900 |
| PSA | 46.33000 |
| LogP | 4.77970 |
| InChIKey | ZRZXHSAMYICAQO-UHFFFAOYSA-N |
| SMILES | CN(C(=O)c1cc(Br)cc(Br)c1N)C1CCCCC1 |
| HS Code | 2924299090 |
|---|
|
~80%
2-amino-3,5-dib... CAS#:3472-84-2 |
| Literature: Larsen, Uffe S.; Begtrup, Mikael; Martiny, Lars Journal of Labelled Compounds and Radiopharmaceuticals, 2005 , vol. 48, # 6 p. 429 - 434 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzamide,2-amino-3,5-dibromo-N-cyclohexyl-N-methyl |
| 2-amino-3,5-dibromo-N-methyl-N-cyclohexylbenzamide |