1-[p-(Methylnitrosamino)benzylideneamino]adamantane structure
|
Common Name | 1-[p-(Methylnitrosamino)benzylideneamino]adamantane | ||
|---|---|---|---|---|
| CAS Number | 34717-44-7 | Molecular Weight | 297.39500 | |
| Density | 1.29g/cm3 | Boiling Point | 471.1ºC at 760 mmHg | |
| Molecular Formula | C18H23N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.7ºC | |
| Name | N-[4-(1-adamantyliminomethyl)phenyl]-N-methylnitrous amide |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 471.1ºC at 760 mmHg |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.39500 |
| Flash Point | 238.7ºC |
| Exact Mass | 297.18400 |
| PSA | 45.03000 |
| LogP | 4.19190 |
| Index of Refraction | 1.675 |
| InChIKey | YIFHEJXZPCZJGB-UHFFFAOYSA-N |
| SMILES | CN(N=O)c1ccc(C=NC23CC4CC(CC(C4)C2)C3)cc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |