2-benzylsulfanylpyridine-4-carboxamide
Modify Date: 2025-08-25 17:52:26
2-benzylsulfanylpyridine-4-carboxamide structure
|
Common Name | 2-benzylsulfanylpyridine-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 347146-27-4 | Molecular Weight | 244.31200 | |
| Density | 1.28g/cm3 | Boiling Point | 447ºC at 760mmHg | |
| Molecular Formula | C13H12N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.2ºC | |
| Name | 2-benzylsulfanylpyridine-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 447ºC at 760mmHg |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.31200 |
| Flash Point | 224.2ºC |
| Exact Mass | 244.06700 |
| PSA | 81.28000 |
| LogP | 3.17310 |
| Index of Refraction | 1.659 |
| InChIKey | OZGBSJBGQSMJOR-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccnc(SCc2ccccc2)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Benzylthio-4-carboxamidepyridine |