1233B
Modify Date: 2025-08-25 10:38:05
1233B structure
|
Common Name | 1233B | ||
|---|---|---|---|---|
| CAS Number | 34668-61-6 | Molecular Weight | 342.427 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 547.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H30O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.0±26.6 °C | |
Use of 1233B1233B is a secondary metabolite from filamentous fungus, Fusarium sp. RK97-94[1]. |
| Name | (2E,4E,7R,13R)-12-Hydroxy-13-(hydroxymethyl)-3,5,7-trimethyl-2,4-tetradecadienedioic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 1233B is a secondary metabolite from filamentous fungus, Fusarium sp. RK97-94[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 547.5±50.0 °C at 760 mmHg |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.427 |
| Flash Point | 299.0±26.6 °C |
| Exact Mass | 342.204254 |
| LogP | 2.27 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | QFZISQBFEIXWDM-UTLPMFLDSA-N |
| SMILES | CC(=CC(=O)O)C=C(C)CC(C)CCCCC(O)C(CO)C(=O)O |
| (2E,4E,7R,13R)-12-Hydroxy-13-(hydroxymethyl)-3,5,7-trimethyl-2,4-tetradecadienedioic acid |
| 2,4-Tetradecadienedioic acid, 12-hydroxy-13-(hydroxymethyl)-3,5,7-trimethyl-, (2E,4E,7R,13R)- |