3-methyl-5-(4-methylpiperazine-1-carbonyl)-1H-pyrrole-2-carbaldehyde
Modify Date: 2025-08-27 19:33:37
3-methyl-5-(4-methylpiperazine-1-carbonyl)-1H-pyrrole-2-carbaldehyde structure
|
Common Name | 3-methyl-5-(4-methylpiperazine-1-carbonyl)-1H-pyrrole-2-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 346600-38-2 | Molecular Weight | 235.28200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-5-(4-methylpiperazine-1-carbonyl)-1H-pyrrole-2-carbaldehyde |
|---|
| Molecular Formula | C12H17N3O2 |
|---|---|
| Molecular Weight | 235.28200 |
| Exact Mass | 235.13200 |
| PSA | 56.41000 |
| LogP | 0.39900 |
| InChIKey | JLDZUPVPIFNZKH-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)N2CCN(C)CC2)[nH]c1C=O |
|
~%
3-methyl-5-(4-m... CAS#:346600-38-2 |
| Literature: Sun; Cui, Jean; Liang, Congxin; Zhou, Yong; Nematalla, Asaad; Wang, Xueyan; Chen, Hui; Tang, Cho; Wei, James Bioorganic and medicinal chemistry letters, 2002 , vol. 12, # 16 p. 2153 - 2157 |
|
~%
3-methyl-5-(4-m... CAS#:346600-38-2 |
| Literature: Sun; Cui, Jean; Liang, Congxin; Zhou, Yong; Nematalla, Asaad; Wang, Xueyan; Chen, Hui; Tang, Cho; Wei, James Bioorganic and medicinal chemistry letters, 2002 , vol. 12, # 16 p. 2153 - 2157 |
|
~0%
3-methyl-5-(4-m... CAS#:346600-38-2 |
| Literature: Liang, Congxin; Sun, Li; Wei, Chung Chen; Tang, Peng Cho; McMahon, Gerald; Hirth, Klaus Peter; Cui, Jingrong Patent: US2002/183319 A1, 2002 ; US 20020183319 A1 |
|
~%
3-methyl-5-(4-m... CAS#:346600-38-2 |
| Literature: Sun; Cui, Jean; Liang, Congxin; Zhou, Yong; Nematalla, Asaad; Wang, Xueyan; Chen, Hui; Tang, Cho; Wei, James Bioorganic and medicinal chemistry letters, 2002 , vol. 12, # 16 p. 2153 - 2157 |
![4-(3-chloro-4-fluoro-phenylamino)-5-[3-methyl-5-(4-methyl-piperazine-1-carbonyl)-1h-pyrrol-2-ylmethylene]-5,7-dihydro-pyrrolo [2,3-d]pyrimidin-6-one structure](https://image.chemsrc.com/caspic/091/346600-00-8.png)