2,4-Imidazolidinedione,5,5-dimethyl-3-(phenylmethyl)- structure
|
Common Name | 2,4-Imidazolidinedione,5,5-dimethyl-3-(phenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 34657-68-6 | Molecular Weight | 218.25200 | |
| Density | 1.176g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-benzyl-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.176g/cm3 |
|---|---|
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.25200 |
| Exact Mass | 218.10600 |
| PSA | 49.41000 |
| LogP | 1.78370 |
| Index of Refraction | 1.554 |
| InChIKey | DSBMOVYUOIIPDK-UHFFFAOYSA-N |
| SMILES | CC1(C)NC(=O)N(Cc2ccccc2)C1=O |
|
~92%
2,4-Imidazolidi... CAS#:34657-68-6 |
| Literature: Tzvetkov, Nikolay T.; Euler, Harald; Mueller, Christa E. Beilstein Journal of Organic Chemistry, 2012 , vol. 8, p. 1584 - 1593 |
|
~95%
2,4-Imidazolidi... CAS#:34657-68-6 |
| Literature: Texas Biotechnology Corporation Patent: US6723711 B2, 2004 ; Location in patent: Page column 49 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-benzyl-5,5-dimethylhydantoin |
| 3-Benzyl-5,5-dimethyl-imidazolidin-2,4-dion |
| 3-benzyl-5,5-dimethyl-2,4-imidazolidinedione |
| Hydantoin,3-benzyl-5,5-dimethyl |
| 3-benzyl-5,5-dimethyl-imidazolidine-2,4-dione |