Fenalcomine
Modify Date: 2025-09-14 03:10:51
Fenalcomine structure
|
Common Name | Fenalcomine | ||
|---|---|---|---|---|
| CAS Number | 34616-39-2 | Molecular Weight | 313.43400 | |
| Density | 1.055g/cm3 | Boiling Point | 465.9ºC at 760mmHg | |
| Molecular Formula | C20H27NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.6ºC | |
| Name | 1-[4-[2-(1-phenylpropan-2-ylamino)ethoxy]phenyl]propan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.055g/cm3 |
|---|---|
| Boiling Point | 465.9ºC at 760mmHg |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.43400 |
| Flash Point | 235.6ºC |
| Exact Mass | 313.20400 |
| PSA | 41.49000 |
| LogP | 4.12050 |
| Index of Refraction | 1.554 |
| InChIKey | DOBLSWXRNYSVDC-UHFFFAOYSA-N |
| SMILES | CCC(O)c1ccc(OCCNC(C)Cc2ccccc2)cc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Fenalcomina [INN-Spanish] |
| Fenalcominum |
| a-ethyl-p-[2-[(a-methylphenethyl)amino]ethoxy]benzyl alcohol |
| UNII-1TBQ3A47P8 |
| Fenalcomina |
| fenalcomine |
| Fenalcominum [INN-Latin] |