ethyl 2-phenylmethoxy-2-phenylmethoxycarbonylamino-propanoate structure
|
Common Name | ethyl 2-phenylmethoxy-2-phenylmethoxycarbonylamino-propanoate | ||
|---|---|---|---|---|
| CAS Number | 34604-07-4 | Molecular Weight | 357.40000 | |
| Density | 1.174g/cm3 | Boiling Point | 514ºC at 760 mmHg | |
| Molecular Formula | C20H23NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.7ºC | |
| Name | ethyl 2-(benzyloxy)-2-(((benzyloxy)carbonyl)amino)propanoate |
|---|
| Density | 1.174g/cm3 |
|---|---|
| Boiling Point | 514ºC at 760 mmHg |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.40000 |
| Flash Point | 264.7ºC |
| Exact Mass | 357.15800 |
| PSA | 73.86000 |
| LogP | 3.79980 |
| Index of Refraction | 1.55 |
| InChIKey | CGOUEQRKXLDDDP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(NC(=O)OCc1ccccc1)OCc1ccccc1 |
|
~%
ethyl 2-phenylm... CAS#:34604-07-4 |
| Literature: Liwschitz,Y. et al. Israel Journal of Chemistry, 1971 , vol. 9, p. 89 - 103 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |