2-nitro-1-[2-nitro-4-(trifluoromethyl)phenoxy]-4-(trifluoromethyl)benzene structure
|
Common Name | 2-nitro-1-[2-nitro-4-(trifluoromethyl)phenoxy]-4-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 346-41-8 | Molecular Weight | 396.19800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H6F6N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-nitro-1-[2-nitro-4-(trifluoromethyl)phenoxy]-4-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H6F6N2O5 |
|---|---|
| Molecular Weight | 396.19800 |
| Exact Mass | 396.01800 |
| PSA | 100.87000 |
| LogP | 6.37930 |
| InChIKey | RNYZRNGBNIOOHT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| HS Code | 2904909090 |
|---|
|
~%
2-nitro-1-[2-ni... CAS#:346-41-8 |
| Literature: Bayer Aktiengesellschaft Patent: US4179461 A1, 1979 ; |
|
~%
2-nitro-1-[2-ni... CAS#:346-41-8 |
| Literature: Finger; Kruse Journal of the American Chemical Society, 1956 , vol. 78, p. 6034,6037 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4,4'-Bis-trifluormethyl-2,2'-dinitro-diphenylaether |