ethyl 2,2,4-trimethyl-5-oxa-1-azabicyclo[4.3.0]nona-6,8-diene-7-carboxylate structure
|
Common Name | ethyl 2,2,4-trimethyl-5-oxa-1-azabicyclo[4.3.0]nona-6,8-diene-7-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 34579-31-2 | Molecular Weight | 237.29500 | |
| Density | 1.14g/cm3 | Boiling Point | 339.3ºC at 760 mmHg | |
| Molecular Formula | C13H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159ºC | |
| Name | ethyl 2,4,4-trimethyl-2,3-dihydropyrrolo[2,1-b][1,3]oxazine-8-carboxylate |
|---|
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 339.3ºC at 760 mmHg |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.29500 |
| Flash Point | 159ºC |
| Exact Mass | 237.13600 |
| PSA | 40.46000 |
| LogP | 2.57090 |
| Index of Refraction | 1.535 |
| InChIKey | GQLANPYLBDZODH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccn2c1OC(C)CC2(C)C |
| HS Code | 2934999090 |
|---|
|
~%
ethyl 2,2,4-tri... CAS#:34579-31-2 |
| Literature: Narwid,T.A.; Meyers,A.I. Journal of Organic Chemistry, 1974 , vol. 39, p. 2572 - 2574 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |