(3β,5α,6α)-3-hydroxy-20-oxo-5,6-epoxypregnan-17-yl acetate
Modify Date: 2025-09-15 17:28:52
(3β,5α,6α)-3-hydroxy-20-oxo-5,6-epoxypregnan-17-yl acetate structure
|
Common Name | (3β,5α,6α)-3-hydroxy-20-oxo-5,6-epoxypregnan-17-yl acetate | ||
|---|---|---|---|---|
| CAS Number | 34553-66-7 | Molecular Weight | 390.51300 | |
| Density | 1.21g/cm3 | Boiling Point | 507.1ºC at 760 mmHg | |
| Molecular Formula | C23H34O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.6ºC | |
| Name | (3β,5α,6α)-3-hydroxy-20-oxo-5,6-epoxypregnan-17-yl acetate |
|---|
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 507.1ºC at 760 mmHg |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.51300 |
| Flash Point | 169.6ºC |
| Exact Mass | 390.24100 |
| PSA | 76.13000 |
| LogP | 3.41220 |
| Index of Refraction | 1.559 |
| InChIKey | MVSNUOQYIMBCLK-XLWMTSDTSA-N |
| SMILES | CC(=O)OC1(C(C)=O)CCC2C3CC4OC45CC(O)CCC5(C)C3CCC21C |
|
~%
(3β,5α,6α)-3-hy... CAS#:34553-66-7 |
| Literature: Bowers et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 5991 |
|
~%
(3β,5α,6α)-3-hy... CAS#:34553-66-7 |
| Literature: Bowers et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 5991 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:336-78-7