3-(2-Hydroxyethyl)-N-(phenylmethyl)-4-pyridinecarboxamide
Modify Date: 2025-08-25 15:29:42
3-(2-Hydroxyethyl)-N-(phenylmethyl)-4-pyridinecarboxamide structure
|
Common Name | 3-(2-Hydroxyethyl)-N-(phenylmethyl)-4-pyridinecarboxamide | ||
|---|---|---|---|---|
| CAS Number | 345311-05-9 | Molecular Weight | 256.30000 | |
| Density | 1.198g/cm3 | Boiling Point | 505.577ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.564ºC | |
| Name | N-benzyl-3-(2-hydroxyethyl)pyridine-4-carboxamide |
|---|
| Density | 1.198g/cm3 |
|---|---|
| Boiling Point | 505.577ºC at 760 mmHg |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30000 |
| Flash Point | 259.564ºC |
| Exact Mass | 256.12100 |
| PSA | 62.22000 |
| LogP | 1.93730 |
| Index of Refraction | 1.603 |
| InChIKey | FLBGFYZICOBEIF-UHFFFAOYSA-N |
| SMILES | O=C(NCc1ccccc1)c1ccncc1CCO |
| HS Code | 2933399090 |
|---|
|
~24%
3-(2-Hydroxyeth... CAS#:345311-05-9 |
| Literature: Bryant, Helen Jane; Chambers, Mark Stuart; Jones, Philip; MacLeod, Angus Murray; Maxey, Robert James Patent: US2003/125333 A1, 2003 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |