N-(Phosphonomethyl)glycine monosodium salt
Modify Date: 2025-08-20 18:19:43
N-(Phosphonomethyl)glycine monosodium salt structure
|
Common Name | N-(Phosphonomethyl)glycine monosodium salt | ||
|---|---|---|---|---|
| CAS Number | 34494-03-6 | Molecular Weight | 191.05500 | |
| Density | N/A | Boiling Point | 465.8ºC at 760 mmHg | |
| Molecular Formula | C3H7NNaO5P | Melting Point | 230ºC (dec) | |
| MSDS | N/A | Flash Point | 235.5ºC | |
| Name | sodium,(carboxymethylamino)methyl-hydroxyphosphinate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 465.8ºC at 760 mmHg |
|---|---|
| Melting Point | 230ºC (dec) |
| Molecular Formula | C3H7NNaO5P |
| Molecular Weight | 191.05500 |
| Flash Point | 235.5ºC |
| Exact Mass | 190.99600 |
| PSA | 119.50000 |
| InChIKey | YWICANUUQPYHOW-UHFFFAOYSA-M |
| SMILES | O=C(O)CNCP(=O)([O-])O.[Na+] |
CHEMICAL IDENTIFICATION
|
|
~99%
N-(Phosphonomet... CAS#:34494-03-6 |
| Literature: STRAITMARK HOLDING AG; BURCK, Sebastian; BRUYNEEL, Frédéric; NOTTÉ, Patrick Patent: WO2014/12991 A1, 2014 ; Location in patent: Paragraph 0130 ; |
|
~0%
N-(Phosphonomet... CAS#:34494-03-6 |
| Literature: Monsanto Technology LLC Patent: US2005/54871 A1, 2005 ; Location in patent: Page/Page column 33 ; |
|
~%
N-(Phosphonomet... CAS#:34494-03-6 |
| Literature: Stauffer Chemical Company Patent: US4415503 A1, 1983 ; |
| sodium salt of glyphosate |
| Sodium glyphosate |
| MON 0459 |
| Glyphosate monosodium salt |
| Glycine,N-(phosphonomethyl)-,monosodium salt |
| trisodium salt of N-phosphomethylglycine |
| tri-sodium salt of N-phosphonomethylglycine |
| N-phosphonomethylglycine (sodium salt) |
| N-Phosphonomethylglycine monosodium salt |
| Sodium Salt of N-Phosphonomethylglycine |
| Glyphosate-sodium |
| Trisodium Salt |
| Glyphosate-sodium [ISO] |