2,5-dihydroxy-5-methyl-3-piperidinocyclopent-2-en-1-one
Modify Date: 2025-08-25 21:16:41
2,5-dihydroxy-5-methyl-3-piperidinocyclopent-2-en-1-one structure
|
Common Name | 2,5-dihydroxy-5-methyl-3-piperidinocyclopent-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 34421-11-9 | Molecular Weight | 211.25800 | |
| Density | 1.336g/cm3 | Boiling Point | 370ºC at 760mmHg | |
| Molecular Formula | C11H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.6ºC | |
| Name | 2,5-dihydroxy-5-methyl-3-piperidin-1-ylcyclopent-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.336g/cm3 |
|---|---|
| Boiling Point | 370ºC at 760mmHg |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.25800 |
| Flash Point | 177.6ºC |
| Exact Mass | 211.12100 |
| PSA | 60.77000 |
| LogP | 0.90360 |
| Index of Refraction | 1.616 |
| InChIKey | HICPSQHUQBAFIQ-UHFFFAOYSA-N |
| SMILES | CC1(O)CC(N2CCCCC2)=C(O)C1=O |
|
~%
2,5-dihydroxy-5... CAS#:34421-11-9 |
| Literature: Hodge; Rist Journal of the American Chemical Society, 1953 , vol. 75, p. 316,320 |
|
~19%
2,5-dihydroxy-5... CAS#:34421-11-9 |
| Literature: Hofmann, Thomas Journal of Agricultural and Food Chemistry, 1998 , vol. 46, # 10 p. 3918 - 3928 |
|
~%
2,5-dihydroxy-5... CAS#:34421-11-9 |
| Literature: Hodge; Rist Journal of the American Chemical Society, 1953 , vol. 75, p. 316,320 |
CAS#:33686-17-8
CAS#:72765-50-5| 2,5-dihydroxy-5-methyl-3-piperidino-cyclopent-2-enone |
| piperidino-hexose-reductone |
| 2,5-dihydroxy-5-methyl-3-piperidinocyclopent-2-en-1-one |
| EINECS 252-008-0 |
| 2,5-Dihydroxy-5-methyl-3-piperidino-cyclopent-2-enon |