6a-(2-bromoethyl)-8,9-dimethoxy-13-(phenylacetyl)-4a,5,6,6a,12,12a,12b,12c-octahydro-6,4-(epiminomethano)-1-oxa-10b-azacyclohepta[1,2,3-cd]fluoranthen-11(2h)-one structure
|
Common Name | 6a-(2-bromoethyl)-8,9-dimethoxy-13-(phenylacetyl)-4a,5,6,6a,12,12a,12b,12c-octahydro-6,4-(epiminomethano)-1-oxa-10b-azacyclohepta[1,2,3-cd]fluoranthen-11(2h)-one | ||
|---|---|---|---|---|
| CAS Number | 34403-85-5 | Molecular Weight | 593.50800 | |
| Density | 1.49g/cm3 | Boiling Point | 795.6ºC at 760 mmHg | |
| Molecular Formula | C31H33BrN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 435ºC | |
| Name | 6a-(2-bromoethyl)-8,9-dimethoxy-13-(phenylacetyl)-4a,5,6,6a,12,12a,12b,12c-octahydro-6,4-(epiminomethano)-1-oxa-10b-azacyclohepta[1,2,3-cd]fluoranthen-11(2h)-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 795.6ºC at 760 mmHg |
| Molecular Formula | C31H33BrN2O5 |
| Molecular Weight | 593.50800 |
| Flash Point | 435ºC |
| Exact Mass | 592.15700 |
| PSA | 68.31000 |
| LogP | 4.26320 |
| Index of Refraction | 1.677 |
| InChIKey | NTAGTWDVBOUVGF-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)C1(CCBr)C3CC4C(=CCOC5CC(=O)N2C1C54)CN3C(=O)Cc1ccccc1 |
|
~%
6a-(2-bromoethy... CAS#:34403-85-5 |
| Literature: Dickstein,J.I.; Miller,S.I. Journal of Organic Chemistry, 1972 , vol. 37, # 13 p. 2175 - 2180 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 18-bromo-2,3-dimethoxy-19-phenylacetyl-18,19-seco-strychnidin-10-one |
| 18-Brom-19-phenylacetyl-18,19-secobrucin |