2-[(3-chlorophenyl)methylideneamino]isoindole-1,3-dione structure
|
Common Name | 2-[(3-chlorophenyl)methylideneamino]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 34403-63-9 | Molecular Weight | 284.69700 | |
| Density | 1.36g/cm3 | Boiling Point | 463.7ºC at 760 mmHg | |
| Molecular Formula | C15H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.2ºC | |
| Name | 2-[(E)-(3-chlorophenyl)methylideneamino]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 463.7ºC at 760 mmHg |
| Molecular Formula | C15H9ClN2O2 |
| Molecular Weight | 284.69700 |
| Flash Point | 234.2ºC |
| Exact Mass | 284.03500 |
| PSA | 49.74000 |
| LogP | 2.90800 |
| Index of Refraction | 1.666 |
| InChIKey | SXMXENXKEMLOIW-RQZCQDPDSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1N=Cc1cccc(Cl)c1 |
|
~87%
2-[(3-chlorophe... CAS#:34403-63-9 |
| Literature: Hearn, Michael J.; Lucero, Elena R. Journal of Heterocyclic Chemistry, 1982 , vol. 19, p. 1537 - 1539 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(3-chlorobenzylimino)-1H-isoindole-1,3(2H)-dione |