1,1,3,3,3-Pentamethyl-1-(2-phenylethyl)propanedisiloxane
Modify Date: 2025-09-19 10:56:21
1,1,3,3,3-Pentamethyl-1-(2-phenylethyl)propanedisiloxane structure
|
Common Name | 1,1,3,3,3-Pentamethyl-1-(2-phenylethyl)propanedisiloxane | ||
|---|---|---|---|---|
| CAS Number | 3439-15-4 | Molecular Weight | 252.50000 | |
| Density | 0.893g/cm3 | Boiling Point | 249.2ºC at 760 mmHg | |
| Molecular Formula | C13H24OSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 88.1ºC | |
| Name | dimethyl-(2-phenylethyl)-trimethylsilyloxysilane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.893g/cm3 |
|---|---|
| Boiling Point | 249.2ºC at 760 mmHg |
| Molecular Formula | C13H24OSi2 |
| Molecular Weight | 252.50000 |
| Flash Point | 88.1ºC |
| Exact Mass | 252.13700 |
| PSA | 9.23000 |
| LogP | 4.28570 |
| Index of Refraction | 1.465 |
| InChIKey | STJDVFLIFYPTDX-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[Si](C)(C)CCc1ccccc1 |
| HS Code | 2934999090 |
|---|
|
~%
1,1,3,3,3-Penta... CAS#:3439-15-4 |
| Literature: Andrianov,K.A. et al. Journal of Organometallic Chemistry, 1965 , vol. 4, p. 360 - 370 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| dimethyl-phenethyl-trimethylsilyloxysilane |
| Pentamethyl-phenaethyl-disiloxan |
| Phenethylpentamethyldisiloxane |