3-(p-chlorophenoxy)-2-methylpropionic acid, compound with 2-(dimethylamino)ethanol (1:1) structure
|
Common Name | 3-(p-chlorophenoxy)-2-methylpropionic acid, compound with 2-(dimethylamino)ethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 34352-64-2 | Molecular Weight | 303.782 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-Chlorophenoxy)-2-methylpropanoic acid-2-(dimethylamino)ethanol (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H22ClNO4 |
|---|---|
| Molecular Weight | 303.782 |
| Exact Mass | 303.123749 |
| InChIKey | VIHNYAXGUFTKSQ-UHFFFAOYSA-N |
| SMILES | CC(COc1ccc(Cl)cc1)C(=O)O.CN(C)CCO |
| Propanoic acid, 3-(4-chlorophenoxy)-2-methyl-, compd. with 2-(dimethylamino)ethanol (1:1) |
| EINECS 251-954-1 |
| 3-(4-Chlorophenoxy)-2-methylpropanoic acid - 2-(dimethylamino)ethanol (1:1) |