benzyl 2-(tert-butylamino)acetate structure
|
Common Name | benzyl 2-(tert-butylamino)acetate | ||
|---|---|---|---|---|
| CAS Number | 343319-03-9 | Molecular Weight | 221.29500 | |
| Density | 1.019g/cm3 | Boiling Point | 301.8ºC at 760 mmHg | |
| Molecular Formula | C13H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.3ºC | |
| Name | benzyl 2-(tert-butylamino)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.019g/cm3 |
|---|---|
| Boiling Point | 301.8ºC at 760 mmHg |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.29500 |
| Flash Point | 136.3ºC |
| Exact Mass | 221.14200 |
| PSA | 38.33000 |
| LogP | 2.50880 |
| Index of Refraction | 1.504 |
| InChIKey | WGJVYWVEWCTCHX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(=O)OCc1ccccc1 |
| HS Code | 2922499990 |
|---|
|
~%
benzyl 2-(tert-... CAS#:343319-03-9 |
| Literature: Roy; Caumes; Esvan; Didierjean; Faure; Taillefumier Organic Letters, 2013 , vol. 15, # 9 p. 2246 - 2249 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| tert-butylamino-acetic acid benzyl ester |