4-(4-n,n-diethylaminophenylazo)aniline
Modify Date: 2025-09-18 12:08:54
4-(4-n,n-diethylaminophenylazo)aniline structure
|
Common Name | 4-(4-n,n-diethylaminophenylazo)aniline | ||
|---|---|---|---|---|
| CAS Number | 34295-45-9 | Molecular Weight | 268.35700 | |
| Density | 1.08g/cm3 | Boiling Point | 452.1ºC at 760mmHg | |
| Molecular Formula | C16H20N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.2ºC | |
| Name | 4-(4-n,n-diethylaminophenylazo)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 452.1ºC at 760mmHg |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.35700 |
| Flash Point | 227.2ºC |
| Exact Mass | 268.16900 |
| PSA | 53.98000 |
| LogP | 5.11160 |
| Index of Refraction | 1.581 |
| InChIKey | GJHHSJRCUUFBLO-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(N=Nc2ccc(N)cc2)cc1 |
| HS Code | 2927000090 |
|---|
|
~88%
4-(4-n,n-diethy... CAS#:34295-45-9 |
| Literature: Pyra, Edmund; Wawrzycki, Slawomir; Modzelewska-Banachiewicz, Bozena Acta Poloniae Pharmaceutica - Drug Research, 1999 , vol. 56, # 2 p. 173 - 177 |
|
~%
4-(4-n,n-diethy... CAS#:34295-45-9 |
| Literature: Jacobs; Heidelberger Journal of Biological Chemistry, 1915 , vol. 21, p. 150 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-diethylamino-4'-aminodiazobenzene |
| 4-Amino-4'-diethylamino-azobenzol |
| 4-Amino-4'-diaethylamino-azobenzol |
| 4-AMINO-4'-N,N-DIETHYLAMINOAZOBENZENE |