(3-methyl-5-propan-2-yl-phenyl) N-(2-oxopentyl)carbamate structure
|
Common Name | (3-methyl-5-propan-2-yl-phenyl) N-(2-oxopentyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 34264-24-9 | Molecular Weight | 277.35900 | |
| Density | 1.051g/cm3 | Boiling Point | 362.2ºC at 760mmHg | |
| Molecular Formula | C16H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.8ºC | |
| Name | promacyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.051g/cm3 |
|---|---|
| Boiling Point | 362.2ºC at 760mmHg |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.35900 |
| Flash Point | 172.8ºC |
| Exact Mass | 277.16800 |
| PSA | 58.89000 |
| LogP | 3.78040 |
| Index of Refraction | 1.51 |
| InChIKey | GGRLUNQHANDPSC-UHFFFAOYSA-N |
| SMILES | CCCC(=O)CNC(=O)Oc1cc(C)cc(C(C)C)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-methyl-5-(propan-2-yl)phenyl butanoyl(methyl)carbamate |
| CRC 7320 |
| CARBAMIC ACID,BUTYRYLMETHYL-,m-CYM-5-YL ESTER |
| Butyrylmethyl carbamic acid m-cym-5-yl ester |
| Promicide |
| 3-methyl-5-(1-methylethyl)phenyl N-methyl-N-(1-oxobutyl)carbamate |
| Promacyl |
| 3-Isopropyl-5-methylphenyl-N-butyryl-N-methyl-carbamat |
| 5-methyl-m-cumenyl butyryl(methyl)carbamate |
| 3-isopropyl-5-methylphenyl butyryl(methyl)carbamate |
| (3-methyl-5-propan-2-ylphenyl) N-(2-oxopentyl)carbamate |