1-amino-4-hydroxy-2-[(6-hydroxyhexyl)oxy]anthraquinone structure
|
Common Name | 1-amino-4-hydroxy-2-[(6-hydroxyhexyl)oxy]anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 34231-26-0 | Molecular Weight | 355.38400 | |
| Density | 1.347 g/cm3 | Boiling Point | 638.6ºC at 760 mmHg | |
| Molecular Formula | C20H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 340ºC | |
| Name | 1-amino-4-hydroxy-2-[(6-hydroxyhexyl)oxy]anthraquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.347 g/cm3 |
|---|---|
| Boiling Point | 638.6ºC at 760 mmHg |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.38400 |
| Flash Point | 340ºC |
| Exact Mass | 355.14200 |
| PSA | 109.85000 |
| LogP | 3.26250 |
| InChIKey | RQLMZSLFKGNXTO-UHFFFAOYSA-N |
| SMILES | Nc1c(OCCCCCCO)cc(O)c2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922509090 |
|---|
|
~%
1-amino-4-hydro... CAS#:34231-26-0 |
| Literature: 3M INNOVATIVE PROPERTIES COMPANY Patent: WO2004/24830 A1, 2004 ; Location in patent: Page 28 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Chemilene Brilliant Pink REL |
| Navilene Brilliant Pink REL |
| Miketon Polyester Pink REL |
| Jaylene Pink REL |
| Amarlene Brilliant Pink REL |
| Kayalon Polyester Pink RCL-E |
| Terenix Pink FRL. |
| Patcosperse Brilliant Pink REL |
| Samaron Pink FRL |