2-(bromomethyl)-2-(4-nitrophenyl)-1,3-dioxolane structure
|
Common Name | 2-(bromomethyl)-2-(4-nitrophenyl)-1,3-dioxolane | ||
|---|---|---|---|---|
| CAS Number | 3418-28-8 | Molecular Weight | 288.09500 | |
| Density | 1.604g/cm3 | Boiling Point | 393.2ºC at 760mmHg | |
| Molecular Formula | C10H10BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.6ºC | |
| Name | 2-(bromomethyl)-2-(4-nitrophenyl)-1,3-dioxolane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.604g/cm3 |
|---|---|
| Boiling Point | 393.2ºC at 760mmHg |
| Molecular Formula | C10H10BrNO4 |
| Molecular Weight | 288.09500 |
| Flash Point | 191.6ºC |
| Exact Mass | 286.97900 |
| PSA | 64.28000 |
| LogP | 2.71250 |
| Index of Refraction | 1.587 |
| InChIKey | NRDICUGTQILBLB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C2(CBr)OCCO2)cc1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Brommethyl-2-<4-nitro-phenyl>-<1,3>dioxolan |
| 2-(3-ETHYLTHIO)-4-HYDROXY-6-METHYL-5-(4-METHYLBENZYL)PYRIMIDINE |