potassium,2-diethoxyphosphorylacetate structure
|
Common Name | potassium,2-diethoxyphosphorylacetate | ||
|---|---|---|---|---|
| CAS Number | 34170-84-8 | Molecular Weight | 234.22900 | |
| Density | N/A | Boiling Point | 315.9ºC at 760 mmHg | |
| Molecular Formula | C6H12KO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.9ºC | |
| Name | potassium,2-diethoxyphosphorylacetate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 315.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C6H12KO5P |
| Molecular Weight | 234.22900 |
| Flash Point | 144.9ºC |
| Exact Mass | 234.00600 |
| PSA | 85.47000 |
| LogP | 0.00240 |
| InChIKey | WSJKHJGZFQQUHF-UHFFFAOYSA-M |
| SMILES | CCOP(=O)(CC(=O)[O-])OCC.[K+] |
| HS Code | 2931900090 |
|---|
|
~90%
potassium,2-die... CAS#:34170-84-8 |
| Literature: Dziemidowicz, Joanna; Witt, Dariusz; Sliwka-Kaszynska, Magdalena; Rachon, Janusz Synthesis, 2005 , # 4 art. no. P12804SS, p. 569 - 574 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Diethylphosphonoessigsaeure Kalium-Salz |
| diethyl phosphonoacetic acid potassium salt |
| P,P-DIETHYL PHOSPHONOACETATE,POTASSIUM SALT |
| potassium diethoxyphosphinylacetate |
| potassium diethylphosphonoacetate |