potassium linoleate
Modify Date: 2025-08-27 00:19:14
potassium linoleate structure
|
Common Name | potassium linoleate | ||
|---|---|---|---|---|
| CAS Number | 3414-89-9 | Molecular Weight | 318.53600 | |
| Density | N/A | Boiling Point | 360.6ºC at 760mmHg | |
| Molecular Formula | C18H31KO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 273ºC | |
| Name | potassium linoleate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 360.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C18H31KO2 |
| Molecular Weight | 318.53600 |
| Flash Point | 273ºC |
| Exact Mass | 318.19600 |
| PSA | 40.13000 |
| LogP | 4.54980 |
| InChIKey | BAYJYBALPIYBQQ-NBTZWHCOSA-M |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)[O-].[K+] |
| HS Code | 2916150000 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916150000 |
|---|---|
| Summary | 2916150000 oleic, linoleic or linolenic acids, their salts and esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| linoleic acid potassium salt |
| 12-octadecadienoic acid (z,z)-potassium salt |
| octadeca-9c,12c-dienoic acid,potassium linolate |
| potassium salt of linoleic acid |
| Octadeca-9c,12c-diensaeure,Kaliumlinolat |
| (9Z,12Z)-9,12-Octadecadienoic acid potassium salt |
| K-linoleate |