Methyl 4-nitrobenzo[b]thiophene-2-carboxylate
Modify Date: 2025-09-25 17:43:22
![Methyl 4-nitrobenzo[b]thiophene-2-carboxylate Structure](https://image.chemsrc.com/caspic/206/34084-87-2.png)
Methyl 4-nitrobenzo[b]thiophene-2-carboxylate structure
|
Common Name | Methyl 4-nitrobenzo[b]thiophene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 34084-87-2 | Molecular Weight | 237.23200 | |
| Density | 1.457g/cm3 | Boiling Point | 393.2ºC at 760 mmHg | |
| Molecular Formula | C10H7NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.6ºC | |
| Name | Methyl 4-nitro-1-benzothiophene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.457g/cm3 |
|---|---|
| Boiling Point | 393.2ºC at 760 mmHg |
| Molecular Formula | C10H7NO4S |
| Molecular Weight | 237.23200 |
| Flash Point | 191.6ºC |
| Exact Mass | 237.01000 |
| PSA | 100.36000 |
| LogP | 3.11930 |
| Index of Refraction | 1.669 |
| InChIKey | SUEKXWDIHCBEHT-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2c([N+](=O)[O-])cccc2s1 |
| HS Code | 2934999090 |
|---|
|
~%
Methyl 4-nitrob... CAS#:34084-87-2 |
| Literature: Lee, Sunkyung; Lee, Hyunsuk; Kyu, Yang Yi; Byung, Ho Lee; Yoo, Sung-Eun; Lee, Kyunghee; Nam, Sook Cho Bioorganic and Medicinal Chemistry Letters, 2005 , vol. 15, # 12 p. 2998 - 3001 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Nitrobenzo<b>thiophen-2-carbonsaeure-methylester |
| 4-Nitrobenzothiophen-2-carbonsaeuremethylester |