isatinecic acid
Modify Date: 2024-02-24 11:00:34
isatinecic acid structure
|
Common Name | isatinecic acid | ||
|---|---|---|---|---|
| CAS Number | 34081-90-8 | Molecular Weight | 232.23000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S,3R,5Z)-5-ethylidene-2-hydroxy-2-(hydroxymethyl)-3-methylhexanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H16O6 |
|---|---|
| Molecular Weight | 232.23000 |
| Exact Mass | 232.09500 |
| PSA | 115.06000 |
| InChIKey | WGBRYLLSVMNVMD-KZQRQWSDSA-N |
| SMILES | CC=C(CC(C)C(O)(CO)C(=O)O)C(=O)O |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Retrorsic acid |
| Isatinecic acid |