ethyl 2-[[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]amino]acetate
Modify Date: 2025-11-07 09:32:16
![ethyl 2-[[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]amino]acetate Structure](https://image.chemsrc.com/caspic/146/340703-52-8.png)
ethyl 2-[[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]amino]acetate structure
|
Common Name | ethyl 2-[[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]amino]acetate | ||
|---|---|---|---|---|
| CAS Number | 340703-52-8 | Molecular Weight | 294.27800 | |
| Density | 1.34g/cm3 | Boiling Point | 512.9ºC at 760 mmHg | |
| Molecular Formula | C14H15FN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264ºC | |
| Name | ethyl 2-[[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]amino]acetate |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 512.9ºC at 760 mmHg |
| Molecular Formula | C14H15FN2O4 |
| Molecular Weight | 294.27800 |
| Flash Point | 264ºC |
| Exact Mass | 294.10200 |
| PSA | 75.71000 |
| LogP | 1.06620 |
| Index of Refraction | 1.565 |
| InChIKey | QACWMXBUFFUDHL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC1CC(=O)N(c2ccc(F)cc2)C1=O |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |