propan-2-yl N-(3-chloro-2-hydroxy-phenyl)carbamate
Modify Date: 2025-09-24 16:28:36
propan-2-yl N-(3-chloro-2-hydroxy-phenyl)carbamate structure
|
Common Name | propan-2-yl N-(3-chloro-2-hydroxy-phenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 34061-86-4 | Molecular Weight | 229.66000 | |
| Density | 1.33g/cm3 | Boiling Point | 264.4ºC at 760 mmHg | |
| Molecular Formula | C10H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.7ºC | |
| Name | propan-2-yl N-(3-chloro-2-hydroxyphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 264.4ºC at 760 mmHg |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66000 |
| Flash Point | 113.7ºC |
| Exact Mass | 229.05100 |
| PSA | 62.05000 |
| LogP | 3.01610 |
| Index of Refraction | 1.59 |
| InChIKey | XWFIJKHIIHQUQF-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)Nc1cccc(Cl)c1O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Isopropyl-3-chlor-2-hydroxycarbanilat |
| Carbanilic acid,3-chloro-2-hydroxy-,isopropyl ester |