Diethyl methyl(phenyl)malonate
Modify Date: 2025-08-26 00:01:42
Diethyl methyl(phenyl)malonate structure
|
Common Name | Diethyl methyl(phenyl)malonate | ||
|---|---|---|---|---|
| CAS Number | 34009-61-5 | Molecular Weight | 250.290 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 315.8±22.0 °C at 760 mmHg | |
| Molecular Formula | C14H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.5±20.7 °C | |
| Name | diethyl 2-methyl-2-phenylpropanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 315.8±22.0 °C at 760 mmHg |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.290 |
| Flash Point | 148.5±20.7 °C |
| Exact Mass | 250.120514 |
| PSA | 52.60000 |
| LogP | 3.06 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.494 |
| InChIKey | KGUIOHXCGVQYEG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C(=O)OCC)c1ccccc1 |
| HS Code | 2917399090 |
|---|
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Methyl-phenyl-malonsaeure-diaethylester |
| diethyl 2-methyl-2-phenylmalonate |
| methyl-phenyl-malonic acid diethyl ester |
| EINECS 251-789-5 |
| 2-methyl-2-phenylmalonic acid diethyl ester |
| Diethyl methyl(phenyl)malonate |
| Propanedioic acid, 2-methyl-2-phenyl-, diethyl ester |
| DIETHYL METHYLPHENYLMALONATE |
| diethyl 2-phenyl-2-methylmalonate |