[2-(Diethoxy-phosphorylamino)-ethyl]-phosphoramidic acid diethyl ester
Modify Date: 2025-08-26 16:04:28
![[2-(Diethoxy-phosphorylamino)-ethyl]-phosphoramidic acid diethyl ester Structure](https://image.chemsrc.com/caspic/165/34008-16-7.png)
[2-(Diethoxy-phosphorylamino)-ethyl]-phosphoramidic acid diethyl ester structure
|
Common Name | [2-(Diethoxy-phosphorylamino)-ethyl]-phosphoramidic acid diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 34008-16-7 | Molecular Weight | 332.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H26N2O6P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of [2-(Diethoxy-phosphorylamino)-ethyl]-phosphoramidic acid diethyl esterC2-Bis-phosphoramidic acid diethyl ester is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | C2-Bis-phosphoramidic acid diethyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | C2-Bis-phosphoramidic acid diethyl ester is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl-Chain |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C10H26N2O6P2 |
|---|---|
| Molecular Weight | 332.27 |
| InChIKey | NGADUQWRPABXQB-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(NCCNP(=O)(OCC)OCC)OCC |
| MFCD25424107 |