2-methyl-3-p-nitrophenyloxaziridine structure
|
Common Name | 2-methyl-3-p-nitrophenyloxaziridine | ||
|---|---|---|---|---|
| CAS Number | 3400-27-9 | Molecular Weight | 180.16100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-3-p-nitrophenyloxaziridine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8N2O3 |
|---|---|
| Molecular Weight | 180.16100 |
| Exact Mass | 180.05300 |
| PSA | 61.36000 |
| LogP | 1.93150 |
| InChIKey | NFQQAEMPMKBSHY-UHFFFAOYSA-N |
| SMILES | CN1OC1c1ccc([N+](=O)[O-])cc1 |
|
~%
2-methyl-3-p-ni... CAS#:3400-27-9 |
| Literature: Auret, Barbara J.; Boyd, Derek R.; Coulter, Peter B. Journal of the Chemical Society, Chemical Communications, 1984 , # 7 p. 463 - 464 |
| Precursor 1 | |
|---|---|
| DownStream 9 | |
| 2-Methyl-3-[4-nitro-phenyl]-oxaziridin |
| 2-methyl-3-(4-nitro-phenyl)-oxaziridine |