2-(3,4-Dichlorophenyl)-2-ethoxy-N1-hydroxyacetamidine structure
|
Common Name | 2-(3,4-Dichlorophenyl)-2-ethoxy-N1-hydroxyacetamidine | ||
|---|---|---|---|---|
| CAS Number | 33954-76-6 | Molecular Weight | 263.12000 | |
| Density | 1.399g/cm3 | Boiling Point | 405.399ºC at 760 mmHg | |
| Molecular Formula | C10H12Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.978ºC | |
| Name | 2-(3,4-dichlorophenyl)-2-ethoxy-N'-hydroxyethanimidamide |
|---|
| Density | 1.399g/cm3 |
|---|---|
| Boiling Point | 405.399ºC at 760 mmHg |
| Molecular Formula | C10H12Cl2N2O2 |
| Molecular Weight | 263.12000 |
| Flash Point | 198.978ºC |
| Exact Mass | 262.02800 |
| PSA | 65.34000 |
| LogP | 3.51770 |
| Index of Refraction | 1.577 |
| InChIKey | SZZUPDHXNKTILB-UHFFFAOYSA-N |
| SMILES | CCOC(C(N)=NO)c1ccc(Cl)c(Cl)c1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |