methyl 4-(4'-ethoxyphenoxycarbonyl)phenyl carbonate
Modify Date: 2025-10-10 19:18:34
methyl 4-(4'-ethoxyphenoxycarbonyl)phenyl carbonate structure
|
Common Name | methyl 4-(4'-ethoxyphenoxycarbonyl)phenyl carbonate | ||
|---|---|---|---|---|
| CAS Number | 33926-17-9 | Molecular Weight | 316.30500 | |
| Density | 1.229g/cm3 | Boiling Point | 462.9ºC at 760 mmHg | |
| Molecular Formula | C17H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.1ºC | |
| Name | methyl 4-(4'-ethoxyphenoxycarbonyl)phenyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.229g/cm3 |
|---|---|
| Boiling Point | 462.9ºC at 760 mmHg |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.30500 |
| Flash Point | 205.1ºC |
| Exact Mass | 316.09500 |
| PSA | 71.06000 |
| LogP | 3.44970 |
| Index of Refraction | 1.552 |
| InChIKey | INRSYFXBODQZAB-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(OC(=O)c2ccc(OC(=O)OC)cc2)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-[(Methoxycarbonyl)oxy] |
| p-Ethoxyphenyl=p-(methoxycarbonyloxy)benzoate |
| 4-[(Methoxycarbonyl)oxy]benzoic acid 4-ethoxyphenyl ester |
| Methylethoxyphenoxycarbonylphenylcarbonate |
| 4-(4'-ETHOXYPHENOXYCARBONYL)PHENYL METHYL CARBONATE |