2,4,6(1H,3H,5H)-Pyrimidinetrione,5-(2-hydroxypropyl)-5-(1-methylbutyl)- structure
|
Common Name | 2,4,6(1H,3H,5H)-Pyrimidinetrione,5-(2-hydroxypropyl)-5-(1-methylbutyl)- | ||
|---|---|---|---|---|
| CAS Number | 33841-18-8 | Molecular Weight | 256.29800 | |
| Density | 1.146g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(2-hydroxypropyl)-5-pentan-2-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.146g/cm3 |
|---|---|
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.29800 |
| Exact Mass | 256.14200 |
| PSA | 95.50000 |
| LogP | 1.20350 |
| Index of Refraction | 1.484 |
| InChIKey | LEAROGYCWPDCOS-UHFFFAOYSA-N |
| SMILES | CCCC(C)C1(CC(C)O)C(=O)NC(=O)NC1=O |
|
~71%
2,4,6(1H,3H,5H)... CAS#:33841-18-8 |
| Literature: Lafont; Chastang; Cave; Miocque European Journal of Medicinal Chemistry, 1988 , vol. 23, # 3 p. 283 - 289 |
|
~72%
2,4,6(1H,3H,5H)... CAS#:33841-18-8 |
| Literature: Lafont; Chastang; Cave; Miocque European Journal of Medicinal Chemistry, 1988 , vol. 23, # 3 p. 283 - 289 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| unii-4wtm4j036b |