5-methoxy-7H-furo[3,2-g][1]benzopyran-7-one structure
|
Common Name | 5-methoxy-7H-furo[3,2-g][1]benzopyran-7-one | ||
|---|---|---|---|---|
| CAS Number | 3380-68-5 | Molecular Weight | 216.19000 | |
| Density | 1.38g/cm3 | Boiling Point | 412.6ºC at 760 mmHg | |
| Molecular Formula | C12H8O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.3ºC | |
| Name | 5-methoxyfuro[3,2-g]chromen-7-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 412.6ºC at 760 mmHg |
| Molecular Formula | C12H8O4 |
| Molecular Weight | 216.19000 |
| Flash Point | 203.3ºC |
| Exact Mass | 216.04200 |
| PSA | 52.58000 |
| LogP | 2.54780 |
| Index of Refraction | 1.647 |
| InChIKey | IFBJMRYEEKIECT-UHFFFAOYSA-N |
| SMILES | COc1cc(=O)oc2cc3occc3cc12 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 222-183-8 |
| 4-methoxypsoralen |